CAS 84023-60-9

5-Benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid

Description:

5-Benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolizine ring system. This compound features a benzoyl group and a bromine atom, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. Its molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for research in pharmacology. The compound's CAS number, 84023-60-9, allows for easy identification in chemical databases and literature. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, 5-Benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid represents a valuable structure for further exploration in synthetic and applied chemistry.

Formula: C₁₅H₁₂BrNO₃

InChI: InChI=1S/C15H12BrNO3/c16-11-8-12(14(18)9-4-2-1-3-5-9)17-7-6-10(13(11)17)15(19)20/h1-5,8,10H,6-7H2,(H,19,20)

InChI key: InChIKey=QUGMOATWHYRJFE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2N(C(C(=O)C3=CC=CC=C3)=CC2Br)CC1

Synonyms:

• 1H-Pyrrolizine-1-carboxylic acid, 5-benzoyl-7-bromo-2,3-dihydro-
• 5-Benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid

Ketorolac Impurity 14

CAS: 84023-60-9

Formula: C₁₅H₁₂BrNO₃

Molecular weight: 334.17

Ref: 4Z-K-0329