CymitQuimica logo

CAS 840488-85-9

:

3-Pyridazinecarboxamide, 6-chloro-N-(2-cyclopropylethyl)-

Description:
3-Pyridazinecarboxamide, 6-chloro-N-(2-cyclopropylethyl)- is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a carboxamide functional group indicates that it has the ability to form hydrogen bonds, contributing to its solubility and reactivity. The chloro substituent at the 6-position of the pyridazine ring introduces a halogen, which can influence the compound's biological activity and reactivity. The N-(2-cyclopropylethyl) moiety suggests that the compound has a branched alkyl chain, which may enhance its lipophilicity and affect its interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and biological activity, would require empirical data for detailed analysis.
Formula:C10H12ClN3O
InChI:InChI=1S/C10H12ClN3O/c11-9-4-3-8(13-14-9)10(15)12-6-5-7-1-2-7/h3-4,7H,1-2,5-6H2,(H,12,15)
InChI key:ZNOCYNRWXAYNOU-UHFFFAOYSA-N
SMILES:C1CC1CCNC(=O)C2=NN=C(C=C2)Cl
Found 3 products.