CAS 84050-22-6

2-Piperazinyl-4-amino-6,7-dimethoxyquinazoline hydrochloride

Description:

2-Piperazinyl-4-amino-6,7-dimethoxyquinazoline hydrochloride is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This substance features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its pharmacological properties. The presence of amino and methoxy groups enhances its solubility and reactivity, making it a potential candidate for various biological applications. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound has been studied for its potential therapeutic effects, particularly in the context of cancer treatment and other diseases, due to its ability to interact with specific biological targets. Its molecular structure allows for various modifications, which can influence its activity and efficacy. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₄H₂₀ClN₅O₂

InChI: InChI=1/C14H19N5O2.ClH/c1-20-11-7-9-10(8-12(11)21-2)17-14(18-13(9)15)19-5-3-16-4-6-19;/h7-8,16H,3-6H2,1-2H3,(H2,15,17,18);1H

InChI key: SKBABQHFLJTFPP-UHFFFAOYSA-N

SMILES: COc1cc2c(cc1OC)nc([nH]c2=N)N1CCNCC1.Cl

Synonyms:

• 4-Quinazolinamine, 6,7-Dimethoxy-2-(1-Piperazinyl)-, Hydrochloride (1:1)
• 6,7-Dimethoxy-2-(piperazin-1-yl)quinazolin-4-amine hydrochloride (1:1)
• 6,7-Dimethoxy-2-Piperazin-1-Ylquinazolin-4-Amine Hydrochloride

2-PADQZ hydrochloride

CAS: 84050-22-6

2-PADQZ hydrochloride

Formula: C₁₅H₂₁ClN₄O₂

Purity: 99.5%

Molecular weight: 324.81

Ref: 54-BUP02618

2-PADQZ hydrochloride

CAS: 84050-22-6

2-PADQZ hydrochloride shows antiviral activity and targets influenza A virus RNA promoter.

Formula: C₁₅H₂₁ClN₄O₂

Purity: 99.61%

Color and Shape: Solid

Molecular weight: 324.806

Ref: TM-T19849L

2-PADQZ Hydrochloride

CAS: 84050-22-6

Formula: C₁₅H₂₁ClN₄O₂

Purity: 99.61%

Molecular weight: 324.8058

Ref: IN-DA00G2PR