CymitQuimica logo

CAS 84057-80-7

:

Propanoic acid, zirconium salt (1:?)

Description:
Propanoic acid, zirconium salt (1:?) is a coordination compound formed from zirconium and propanoic acid, characterized by its metal-organic framework. This compound typically exhibits properties associated with both organic acids and metal salts, including solubility in organic solvents and potential reactivity with various substrates. The presence of zirconium contributes to its stability and may enhance its catalytic properties in certain chemical reactions. The compound is often utilized in applications such as catalysis, materials science, and as a precursor in the synthesis of zirconium-based materials. Its structure may involve coordination bonds between the zirconium ion and the carboxylate groups of propanoic acid, influencing its physical and chemical properties. Safety data indicates that, like many metal salts, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, propanoic acid, zirconium salt is a versatile compound with applications in various fields of chemistry and materials science.
Formula:C3H6O2·xZr
InChI:InChI=1S/C3H6O2.Zr/c1-2-3(4)5;/h2H2,1H3,(H,4,5);
InChI key:InChIKey=UADUAXMDVVGCGW-UHFFFAOYSA-N
SMILES:C(CC)(O)=O.[Zr]
Synonyms:
  • Propanoic acid, zirconium salt (1:?)
  • Propanoic acid, zirconium salt
  • Zirconium propionate
  • Propanoate, Zirconium(4+) Salt (1:1)
Found 1 products.