CymitQuimica logo

CAS 84099-58-1

:

4-Benzofuranol, 4,5,6,7-tetrahydro-

Description:
4-Benzofuranol, 4,5,6,7-tetrahydro- is an organic compound characterized by its bicyclic structure, which consists of a benzofuran moiety with a tetrahydrofuran ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its unique reactivity and potential applications in organic synthesis. It is generally a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of hydroxyl (-OH) groups in its structure imparts polar characteristics, making it soluble in various organic solvents while exhibiting limited solubility in water. Its chemical behavior is influenced by the functional groups present, allowing for various reactions such as oxidation, reduction, and substitution. 4-Benzofuranol derivatives are of interest in medicinal chemistry due to their potential biological activities, including anti-inflammatory and antioxidant properties. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C8H10O2
InChI:InChI=1S/C8H10O2/c9-7-2-1-3-8-6(7)4-5-10-8/h4-5,7,9H,1-3H2
InChI key:ULJDDPKYJJHVCG-UHFFFAOYSA-N
SMILES:C1CC(C2=C(C1)OC=C2)O
Synonyms:
  • 4,5,6,7-Tetrahydrobenzofuran-4-Ol
Found 2 products.