CymitQuimica logo

CAS 84100-84-5

:

2,3,3-Trimethyl-3H-indole-5-carboxylic acid

Description:
2,3,3-Trimethyl-3H-indole-5-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features three methyl groups at the 2 and 3 positions of the indole ring, contributing to its unique properties. The presence of a carboxylic acid functional group at the 5 position enhances its acidity and solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of multiple methyl groups can influence its steric and electronic properties, affecting its reactivity and stability. As with many indole derivatives, it may exhibit interesting biological activities, although specific applications would depend on further research and characterization.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c1-7-12(2,3)9-6-8(11(14)15)4-5-10(9)13-7/h4-6H,1-3H3,(H,14,15)
InChI key:InChIKey=QUDAPQXQGBIUAR-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(N=C1C)=CC=C(C(O)=O)C2
Synonyms:
  • 2,3,3-Trimethyl-5-carboxyindolenine
  • 5-Carboxyl-2,3,3-trimethyl-3H-indolenine
  • 3H-Indole-5-carboxylic acid, 2,3,3-trimethyl-
  • 2,3,3-Trimethyl-3H-indole-5-carboxylic acid
Found 7 products.