CAS 841275-78-3

Formula: C11H12ClNO3S

InChI: InChI=1S/C11H12ClNO3S/c1-7-5-9-6-10(17(12,15)16)3-4-11(9)13(7)8(2)14/h3-4,6-7H,5H2,1-2H3

InChI key: VMIKNPLJAZXOOM-UHFFFAOYSA-N

SMILES: CC1CC2=C(N1C(=O)C)C=CC(=C2)S(=O)(=O)Cl

1-Acetyl-2-methylindoline-5-sulphonyl chloride

CAS: 841275-78-3

1-Acetyl-2-methylindoline-5-sulphonyl chloride

Formula: C₁₁H₁₂ClNO₃S

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 273.73588

Ref: 54-OR3671

1-Acetyl-2-methylindoline-5-sulphonyl Chloride

CAS: 841275-78-3

Formula: C₁₁H₁₂ClNO₃S

Purity: 95%

Molecular weight: 273.7359

Ref: IN-DA00G4JJ

1-Acetyl-2-methylindoline-5-sulfonyl chloride

CAS: 841275-78-3

1-Acetyl-2-methylindoline-5-sulfonyl chloride

Formula: C₁₁H₁₂ClNO₃S

Purity: 95%

Molecular weight: 273.74

Ref: IN-DG201102

1-Acetyl-2-methylindoline-5-sulfonyl chloride

CAS: 841275-78-3

Purity: 95.0%

Molecular weight: 273.7300109863281

Ref: 10-F441613

1-Acetyl-2-methylindoline-5-sulphonyl chloride

CAS: 841275-78-3

1-Acetyl-2-methylindoline-5-sulphonyl chloride (AMSC) is a molecule that is active in glycolysis, the process by which glucose is broken down to produce energy. AMSC inhibits the formation of ATP and reduces the rate of glycolysis. This effect can be observed as a shift in the dimerization equilibrium towards monomers. AMSC also has anti-cancer effects, with its most potent activity on colorectal cancer cells. The prevalence of AMSC in human cells is dependent on the type of cell; for example, it is more prevalent in liver cells than in lung cells.

Formula: C₁₁H₁₂ClNO₃S

Purity: Min. 95%

Molecular weight: 273.74 g/mol

Ref: 3D-RIB27578