CymitQuimica logo

CAS 841302-37-2

:

4-azabicyclo[3.1.0]hexane hydrochloride

Description:
4-Azabicyclo[3.1.0]hexane hydrochloride is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into the ring system. This compound features a six-membered ring with a nitrogen atom replacing one of the carbon atoms, resulting in a piperidine-like structure. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical chemistry. The compound is typically used in research settings, especially in studies related to neurochemistry and medicinal chemistry, due to its potential interactions with neurotransmitter systems. Its molecular structure contributes to its biological activity, and it may exhibit properties such as being a ligand for certain receptors. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, making it a valuable compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C5H10ClN
InChI:InChI=1S/C5H9N.ClH/c1-2-6-5-3-4(1)5;/h4-6H,1-3H2;1H
InChI key:GVKIWNRVZPBLKT-UHFFFAOYSA-N
SMILES:C1CNC2C1C2.Cl
Synonyms:
  • 2,3-Methanopyrrolidine Hydrochloride Salt
Found 4 products.