CymitQuimica logo

CAS 84138-75-0

:

1,3,4-Thiadiazol-2-amine, 5-[(2-methylphenoxy)methyl]-

Description:
1,3,4-Thiadiazol-2-amine, 5-[(2-methylphenoxy)methyl]- is a chemical compound characterized by its thiadiazole ring, which contributes to its unique properties. The presence of the amine group at the 2-position of the thiadiazole enhances its potential for hydrogen bonding and reactivity, making it a candidate for various applications in pharmaceuticals and agrochemicals. The 5-[(2-methylphenoxy)methyl]- substituent introduces a hydrophobic aromatic character, which can influence the compound's solubility and biological activity. This compound may exhibit antimicrobial, antifungal, or herbicidal properties, typical of many thiadiazole derivatives. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors, which is crucial for its application in different fields. Overall, 1,3,4-Thiadiazol-2-amine, 5-[(2-methylphenoxy)methyl]- represents a versatile scaffold for further chemical modifications and research into its biological effects.
Formula:C10H11N3OS
InChI:InChI=1S/C10H11N3OS/c1-7-4-2-3-5-8(7)14-6-9-12-13-10(11)15-9/h2-5H,6H2,1H3,(H2,11,13)
InChI key:PLCIFNBRXSUNMJ-UHFFFAOYSA-N
SMILES:CC1=CC=CC=C1OCC2=NN=C(S2)N
Found 1 products.