CymitQuimica logo

CAS 84166-37-0

:

7,10,13-Trioxa-4-azahexadecan-1-aminium,N,N-diethyl-6,8,8,9,11,11,12,14,14,15,15,16,16,16-tetradecafluoro-N-methyl-5-oxo-6,9,12-tris(trifluoromethyl)-,iodide (1:1)

Description:
The chemical substance known as "7,10,13-Trioxa-4-azahexadecan-1-aminium, N,N-diethyl-6,8,8,9,11,11,12,14,14,15,15,16,16,16-tetradecafluoro-N-methyl-5-oxo-6,9,12-tris(trifluoromethyl)-, iodide (1:1)" with CAS number 84166-37-0 is a complex organic compound characterized by its unique structure, which includes multiple functional groups such as aminium, oxo, and trifluoromethyl moieties. This compound is likely to exhibit significant hydrophilicity due to the presence of the aminium group, while the extensive fluorination suggests strong hydrophobic characteristics, potentially leading to interesting surfactant properties. The presence of iodine in its structure may impart specific reactivity or biological activity. Additionally, the compound's long carbon chain and multiple heteroatoms contribute to its potential applications in various fields, including materials science and pharmaceuticals. Its stability, solubility, and reactivity would depend on the specific environmental conditions and the presence of other chemical species. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential utility in advanced applications.
Formula:C20H20F23N2O4I
InChI:InChI=1S/C20H19F23N2O4.HI/c1-4-45(3,5-2)8-6-7-44-9(46)10(21,14(26,27)28)47-19(40,41)12(24,16(32,33)34)49-20(42,43)13(25,17(35,36)37)48-18(38,39)11(22,23)15(29,30)31;/h4-8H2,1-3H3;1H
InChI key:CMECKCJZKNMJHB-UHFFFAOYSA-N
SMILES:CC[N+](C)(CC)CCCNC(=O)C(C(F)(F)F)(OC(C(C(F)(F)F)(OC(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)(F)F)F)(F)F)F.[I-]
Synonyms:
  • 4,7,10-Trioxa-13-azahexadecan-16-aminium,N,N-diethyl-1,1,1,2,2,3,3,5,6,6,8,9,9,11-tetradecafluoro-N-methyl-12-oxo-5,8,11-tris(trifluoromethyl)-,iodide (9CI)
  • Fc 4
  • FC 4 (surfactant)
Found 2 products.