CymitQuimica logo

CAS 84228-44-4

:

Methyl 4-amino-3-chlorobenzoate

Description:
Methyl 4-amino-3-chlorobenzoate, with the CAS number 84228-44-4, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which includes an amino group and a chlorine substituent on the aromatic ring. This compound typically appears as a solid or crystalline substance and is characterized by its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Methyl 4-amino-3-chlorobenzoate may be used in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its chemical stability and reactivity can be influenced by the electron-withdrawing chlorine atom and the electron-donating amino group, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,10H2,1H3
InChI key:WKVJBYKFGNVWLM-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(c(c1)Cl)N
Synonyms:
  • Benzoic acid, 4-amino-3-chloro-, methyl ester
  • Methyl 4-amino-3-chlorobenzoate
Found 6 products.