CymitQuimica logo

CAS 84277-81-6

:

L-2-aminodecanoic acid

Description:
L-2-aminodecanoic acid, also known as L-2-aminodecanoate, is an amino acid characterized by its long carbon chain, consisting of ten carbon atoms. It features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. This compound is classified as a non-polar, aliphatic amino acid due to its hydrophobic carbon chain. It plays a role in various biochemical processes and can be involved in protein synthesis. The presence of the amino group allows it to participate in peptide bond formation, making it relevant in the context of protein structure and function. Additionally, L-2-aminodecanoic acid may exhibit properties such as solubility in polar solvents, though its long hydrophobic tail can limit its solubility in water. Its CAS number, 84277-81-6, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, L-2-aminodecanoic acid is significant in both biological and synthetic chemistry contexts.
Formula:C10H21NO2
InChI:InChI=1S/C10H21NO2/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9H,2-8,11H2,1H3,(H,12,13)/t9-/m0/s1
InChI key:JINGUCXQUOKWKH-VIFPVBQESA-N
SMILES:CCCCCCCC[C@@H](C(=O)O)N
Synonyms:
  • (2S)-2-Amino-decanoic acid
  • (S)-2-amino-decanoic acid
  • L-2-Aminodecanoic acid(S-form)
  • L-decyline
  • S-form
  • (S)-2-Amino-decansaeure
  • 3S-aminodecanoic acid
Found 4 products.