CymitQuimica logo

CAS 84296-41-3

:

2,8-diazaspiro[5.5]undecane-1,7-dione

Description:
2,8-Diazaspiro[5.5]undecane-1,7-dione is a bicyclic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a larger carbon framework. This compound features a spirocyclic arrangement, where two rings share a single carbon atom, contributing to its rigidity and potential for unique chemical reactivity. The presence of two carbonyl (C=O) groups at the 1 and 7 positions of the undecane backbone indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The nitrogen atoms in the structure can also influence its basicity and potential for forming coordination complexes with metal ions. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, would depend on the specific functional groups and the overall molecular structure. As with many nitrogen-containing compounds, it may also display unique spectroscopic characteristics useful for identification and analysis.
Formula:C9H14N2O2
InChI:InChI=1/C9H14N2O2/c12-7-9(3-1-5-10-7)4-2-6-11-8(9)13/h1-6H2,(H,10,12)(H,11,13)
InChI key:NBYYWDISYKXXLL-UHFFFAOYSA-N
SMILES:C1CC2(CCCN=C2O)C(=NC1)O
Synonyms:
  • 2,8-Diazaspiro[5.5]undecan-1,7-dion
Found 4 products.