CymitQuimica logo

CAS 842971-89-5

:

N~1~,N~1~-diethyl-1-furan-2-ylethane-1,2-diamine

Description:
N,N-Diethyl-1-furan-2-ylethane-1,2-diamine is an organic compound characterized by its unique structure, which includes a furan ring and two ethyl groups attached to the nitrogen atoms of the amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the furan ring contributes to its potential reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the ethyl groups can enhance lipophilicity, affecting its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development or as a building block for more complex chemical structures. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper use and minimize risks associated with exposure.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c1-3-12(4-2)9(8-11)10-6-5-7-13-10/h5-7,9H,3-4,8,11H2,1-2H3
InChI key:XIBTZZUXZNNSTP-UHFFFAOYSA-N
SMILES:CCN(CC)C(CN)c1ccco1
Synonyms:
  • 1,2-ethanediamine, N~1~,N~1~-diethyl-1-(2-furanyl)-
  • N~1~,N~1~-Diethyl-1-(2-furyl)ethane-1,2-diamine
  • N~1~,N~1~-diethyl-1-(furan-2-yl)ethane-1,2-diamine
Found 1 products.