CymitQuimica logo

CAS 842973-82-4

:

2-methyl-1-(prop-2-yn-1-yl)-1H-indole-3-carbaldehyde

Description:
2-Methyl-1-(prop-2-yn-1-yl)-1H-indole-3-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group at the 2-position and a prop-2-yn-1-yl group at the 1-position of the indole, along with an aldehyde functional group at the 3-position. The presence of the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. The alkyne substituent adds to its complexity and may influence its physical properties, such as solubility and boiling point. This compound may exhibit interesting biological activities due to the indole moiety, which is known for its presence in many natural products and pharmaceuticals. Its unique structure and functional groups make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c1-3-8-14-10(2)12(9-15)11-6-4-5-7-13(11)14/h1,4-7,9H,8H2,2H3
InChI key:IXEINIMITYPXLQ-UHFFFAOYSA-N
SMILES:C#CCn1c(C)c(C=O)c2ccccc12
Found 4 products.