CAS 842974-35-0

Benzenamine, 4-(3-methyl-1-piperidinyl)-

Description:

Benzenamine, 4-(3-methyl-1-piperidinyl)-, also known by its CAS number 842974-35-0, is an organic compound that features a benzene ring substituted with an amine group and a piperidine moiety. This compound exhibits characteristics typical of amines, including basicity due to the presence of the nitrogen atom in the piperidine ring, which can accept protons. The piperidine ring contributes to its cyclic structure and can influence its reactivity and interaction with biological systems. The presence of the methyl group on the piperidine enhances steric effects and may affect the compound's solubility and lipophilicity. Generally, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties, including their role as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients themselves. The compound's specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be referenced from experimental data or literature for precise applications.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c1-10-3-2-8-14(9-10)12-6-4-11(13)5-7-12/h4-7,10H,2-3,8-9,13H2,1H3

InChI key: IKOVMWFMUDURMX-UHFFFAOYSA-N

SMILES: CC1CCCN(C1)C2=CC=C(C=C2)N

4-(3-Methyl-piperidin-1-yl)-phenylamine

CAS: 842974-35-0

4-(3-Methyl-piperidin-1-yl)-phenylamine

Formula: C₁₂H₁₈N₂

Molecular weight: 190.29

Ref: 10-F059381