CymitQuimica logo

CAS 84333-59-5

:

2-(methylamino)-2-phenylbutyl 3,4,5-trimethoxybenzoate

Description:
2-(Methylamino)-2-phenylbutyl 3,4,5-trimethoxybenzoate, identified by its CAS number 84333-59-5, is a chemical compound that belongs to the class of substituted phenylbutylamines. This substance features a phenyl group attached to a butyl chain, which is further substituted with a methylamino group, enhancing its potential for biological activity. The presence of the 3,4,5-trimethoxybenzoate moiety suggests that it may exhibit interesting pharmacological properties, possibly related to neurotransmitter modulation. The methoxy groups can influence the compound's lipophilicity and solubility, potentially affecting its absorption and distribution in biological systems. Additionally, the structural characteristics may allow for interactions with various receptors or enzymes, making it a candidate for research in medicinal chemistry. However, specific details regarding its toxicity, stability, and reactivity would require further investigation through empirical studies. As with many compounds in this category, understanding its behavior in biological systems is crucial for assessing its therapeutic potential and safety profile.
Formula:C21H27NO5
InChI:InChI=1/C21H27NO5/c1-6-21(22-2,16-10-8-7-9-11-16)14-27-20(23)15-12-17(24-3)19(26-5)18(13-15)25-4/h7-13,22H,6,14H2,1-5H3
InChI key:ZFPDLGDYDUPYEZ-UHFFFAOYSA-N
SMILES:CCC(COC(=O)c1cc(c(c(c1)OC)OC)OC)(c1ccccc1)NC
Synonyms:
  • Benzoic acid, 3,4,5-trimethoxy-, 2-(methylamino)-2-phenylbutyl ester
Found 2 products.