CAS 84344-20-7
:dl-serine-1-13C
Description:
dl-Serine-1-13C is a stable isotope-labeled form of the amino acid serine, where the carbon atom at the first position is replaced with the carbon-13 isotope. This compound is characterized by its role as a non-essential amino acid, which is crucial for protein synthesis and various metabolic processes. It is involved in the biosynthesis of other amino acids and neurotransmitters, particularly in the central nervous system. The presence of the carbon-13 isotope allows for its use in metabolic studies and tracer experiments, providing insights into metabolic pathways and the dynamics of amino acid utilization in biological systems. dl-Serine-1-13C is typically used in research settings, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to trace metabolic processes. As a chemical substance, it is generally stable under standard laboratory conditions, soluble in water, and can be utilized in various biochemical applications.
Formula:C3H7NO3
InChI:InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/i3+1
InChI key:MTCFGRXMJLQNBG-LBPDFUHNSA-N
SMILES:C(C([13C](=O)O)N)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
