CymitQuimica logo

CAS 84359-61-5

:

9H-Carbazole, 9-(3-bromopropyl)-

Description:
9H-Carbazole, 9-(3-bromopropyl)-, with the CAS number 84359-61-5, is an organic compound that features a carbazole core, which is a fused bicyclic structure consisting of a benzene ring and a pyrrole ring. This compound is characterized by the presence of a bromopropyl substituent at the 9-position of the carbazole structure, which introduces both bromine and a propyl chain into the molecule. The bromine atom enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the propyl group can influence the compound's solubility and interaction with other molecules, potentially affecting its applications in organic synthesis, materials science, and pharmaceuticals. Additionally, carbazole derivatives are known for their photophysical properties, which may be relevant in applications such as organic light-emitting diodes (OLEDs) and other electronic devices. Overall, 9H-Carbazole, 9-(3-bromopropyl)- exhibits unique chemical characteristics that make it a subject of interest in various fields of research.
Formula:C15H14BrN
InChI:InChI=1S/C15H14BrN/c16-10-5-11-17-14-8-3-1-6-12(14)13-7-2-4-9-15(13)17/h1-4,6-9H,5,10-11H2
InChI key:KJSZNBRGRCCYHF-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=CC=CC=C3N2CCCBr
Found 4 products.