CymitQuimica logo

CAS 84424-74-8

:

1,2,4-Triazine-6-propanoic acid,4-amino-2,3,4,5-tetrahydro-5-oxo-3-thioxo-

Description:
1,2,4-Triazine-6-propanoic acid, 4-amino-2,3,4,5-tetrahydro-5-oxo-3-thioxo- is a chemical compound characterized by its unique triazine ring structure, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the propanoic acid moiety indicates that it has acidic properties, while the amino group suggests potential for hydrogen bonding and interaction with biological systems. The tetrahydro-5-oxo-3-thioxo structure implies that the compound may exhibit diverse chemical behavior, including the ability to participate in redox reactions or act as a nucleophile. Its CAS number, 84424-74-8, allows for easy identification in chemical databases. This compound may also possess specific solubility characteristics, stability under various conditions, and potential biological activity, making it of interest for further research and development. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest in synthetic chemistry and medicinal applications.
Formula:C6H8N4O3S
InChI:InChI=1S/C6H8N4O3S/c7-10-5(13)3(1-2-4(11)12)8-9-6(10)14/h1-2,7H2,(H,9,14)(H,11,12)
InChI key:UDRLQUBSFWAFSO-UHFFFAOYSA-N
SMILES:C(CC(=O)O)C1=NNC(=S)N(C1=O)N
Found 1 products.