CAS 84434-05-9
:2-(Carboxymethoxy)thioxanthone
Description:
2-(Carboxymethoxy)thioxanthone, with the CAS number 84434-05-9, is an organic compound that belongs to the thioxanthone family, which are polycyclic aromatic compounds known for their photochemical properties. This substance features a thioxanthone core structure, characterized by a fused ring system containing sulfur, along with a carboxymethoxy functional group that enhances its solubility and reactivity. The presence of the carboxymethoxy group allows for potential applications in various fields, including photoinitiators in polymerization processes, as it can absorb UV light and generate reactive species. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its environment and structural modifications. Its chemical stability and reactivity can be influenced by factors such as pH and solvent polarity, making it a versatile candidate for research in organic synthesis and materials science. Overall, 2-(Carboxymethoxy)thioxanthone is a significant compound in the study of photochemical applications and organic materials.
Formula:C15H10O4S
InChI:InChI=1S/C15H10O4S/c16-14(17)8-19-9-5-6-13-11(7-9)15(18)10-3-1-2-4-12(10)20-13/h1-7H,8H2,(H,16,17)
InChI key:InChIKey=LJUKODJASZSKFL-UHFFFAOYSA-N
SMILES:O=C1C=2C(SC=3C1=CC=CC3)=CC=C(OCC(O)=O)C2
Synonyms:- Acetic acid, 2-[(9-oxo-9H-thioxanthen-2-yl)oxy]-
- 2-(Carboxymethoxy)thioxanthone
- 2-Thioxanthonyloxyacetic acid
- Acetic acid, [(9-oxo-9H-thioxanthen-2-yl)oxy]-
- 2-[(9-Oxo-9H-thioxanthen-2-yl)oxy]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-((9-Oxo-9H-Thioxanthen-2-Yl)Oxy)Acetic Acid
CAS:2-((9-Oxo-9H-Thioxanthen-2-Yl)Oxy)Acetic AcidFormula:C15H10O4SPurity:97%Molecular weight:286.3[(9-OXO-9H-THIOXANTHEN-2-YL)OXY]ACETIC ACID
CAS:Formula:C15H10O4SPurity:97%Color and Shape:SolidMolecular weight:286.30252-((9-Oxo-9H-thioxanthen-2-yl)oxy)acetic acid
CAS:2-((9-Oxo-9H-thioxanthen-2-yl)oxy)acetic acidFormula:C15H10O4SPurity:97%Molecular weight:286.32-(Carboxymethoxy)-thioxanthone
CAS:2-(Carboxymethoxy)-thioxanthone is a photophysical compound that absorbs light in the ultraviolet region. It has been shown to undergo photolysis, with the release of sulfur and proton transfer. 2-(Carboxymethoxy)-thioxanthone is bifunctional, with parameters that are different for each reaction. The reactivity of this compound depends on the type of laser irradiation and solvent used as well as the wavelength of light. This molecule can be used in photoinitiators and postulated as a possible replacement for methyl methacrylate in laser-based polymerization techniques such as transfer or electron beam.
Formula:C15H10O4SPurity:Min. 95%Molecular weight:286.3 g/mol



