CymitQuimica logo

CAS 844499-71-4

:

4-Hydroxy-3-(2'-hydroxy-1,1'-biphenyl-4-yl)-6-oxo-6,7-dihydrothieno[2,3-b]pyridine-5-carbonitrile

Description:
4-Hydroxy-3-(2'-hydroxy-1,1'-biphenyl-4-yl)-6-oxo-6,7-dihydrothieno[2,3-b]pyridine-5-carbonitrile is a complex organic compound characterized by its unique structural features, including a thieno[2,3-b]pyridine core, hydroxyl groups, and a carbonitrile functional group. This compound exhibits a range of chemical properties due to the presence of multiple functional groups, which can influence its reactivity and solubility. The hydroxyl groups contribute to its potential for hydrogen bonding, enhancing solubility in polar solvents. The carbonitrile group may impart additional reactivity, making it a candidate for various chemical transformations. Its thieno[2,3-b]pyridine framework suggests potential biological activity, as many compounds with similar structures have been investigated for pharmacological properties. The compound's molecular complexity may also lead to interesting electronic properties, making it a subject of interest in materials science and organic electronics. Overall, this substance's unique combination of functional groups and structural motifs positions it as a potentially valuable compound in both synthetic chemistry and medicinal applications.
Formula:C20H12N2O3S
InChI:InChI=1S/C20H12N2O3S/c21-9-14-18(24)17-15(10-26-20(17)22-19(14)25)12-7-5-11(6-8-12)13-3-1-2-4-16(13)23/h1-8,10,23H,(H2,22,24,25)
InChI key:CTESJDQKVOEUOY-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=CC=C(C=C2)C3=CSC4=C3C(=C(C(=O)N4)C#N)O)O
Synonyms:
  • A 769662
  • A769662
  • Thieno[2,3-b]pyridine-5-carbonitrile,6,7-dihydro-4-hydroxy-3-(2'-hydroxy[1,1'-biphenyl]-4-yl)-6-oxo-
Found 8 products.