CAS 844501-71-9
:1H-Pyrazole-3-boronic acid pinacol ester
Description:
1H-Pyrazole-3-boronic acid pinacol ester is an organoboron compound characterized by the presence of a pyrazole ring and a boronic acid functional group, which is esterified with pinacol. This compound typically exhibits properties associated with boron-containing compounds, such as the ability to participate in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The pyrazole moiety contributes to its potential biological activity, as pyrazole derivatives are known for various pharmacological properties. The pinacol ester form enhances the stability and solubility of the boronic acid, facilitating its use in various chemical reactions. Additionally, this compound may exhibit moderate polarity due to the presence of both hydrophobic (pyrazole) and hydrophilic (boronic acid) components. Its reactivity is influenced by the boron atom, which can form coordination complexes and participate in nucleophilic substitutions. Overall, 1H-Pyrazole-3-boronic acid pinacol ester is a versatile compound with applications in synthetic organic chemistry and potential therapeutic uses.
Formula:C9H15BN2O2
InChI:InChI=1/C9H15BN2O2/c1-8(2)9(3,4)14-10(13-8)7-5-6-11-12-7/h5-6H,1-4H3,(H,11,12)
SMILES:CC1(C)C(C)(C)OB(c2cc[nH]n2)O1
Synonyms:- 1H-pyrazole, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1H-pyrazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 3-(4,4,5,5-Tetramethyl-1,3,2-Dioxabolone)-Pyrrazole
- 3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane)-Pyrazole
- Pyrazole-3-boronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C9H15BN2O2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:194.041H-Pyrazole-3-boronic acid pinacol ester, 95%
CAS:1H-Pyrazole-3-boronic acid pinacol ester is used as an intermediate in organic synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product /Formula:C9H15BN2O2Purity:95%Color and Shape:White, PowderMolecular weight:194.04Pyrazole-3-boronic acid, pinacol ester
CAS:Formula:C9H15BN2O2Purity:97%Color and Shape:SolidMolecular weight:194.03861H-Pyrazole-3-boronic acid, pinacol ester
CAS:1H-Pyrazole-3-boronic acid, pinacol esterFormula:C9H15BN2O2Purity:97%Color and Shape:Solid-PowderMolecular weight:194.038591H-Pyrazole-5-boronic acid, pinacol ester
CAS:1H-Pyrazole-5-boronic acid, pinacol esterFormula:C9H15BN2O2Purity:≥95%Color and Shape:SolidMolecular weight:194.038593-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C9H15BN2O2Purity:97%Color and Shape:SolidMolecular weight:194.04




