CymitQuimica logo

CAS 844646-88-4

:

5-Quinoxalinesulfonylchloride

Description:
5-Quinoxalinesulfonylchloride is a chemical compound characterized by the presence of a quinoxaline ring, which is a bicyclic structure composed of two fused aromatic rings containing nitrogen atoms. This compound features a sulfonyl chloride functional group, which is known for its reactivity and ability to act as a sulfonating agent. Typically, sulfonyl chlorides are used in organic synthesis for the introduction of sulfonyl groups into various substrates. The presence of the quinoxaline moiety may impart specific biological activities, making this compound of interest in medicinal chemistry. It is generally a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions. As with many sulfonyl chlorides, it can release hydrochloric acid upon reaction, necessitating appropriate safety precautions during use. Overall, 5-Quinoxalinesulfonylchloride serves as a valuable intermediate in the synthesis of more complex organic molecules, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H5ClN2O2S
InChI:InChI=1S/C8H5ClN2O2S/c9-14(12,13)7-3-1-2-6-8(7)11-5-4-10-6/h1-5H
InChI key:NAKORIYAIZIQHQ-UHFFFAOYSA-N
SMILES:C1=CC2=NC=CN=C2C(=C1)S(=O)(=O)Cl
Synonyms:
  • Quinoxaline-5-sulfonylchloride
Found 5 products.