CAS 84466-05-7

methyl 5-chloro-2-{[(trifluoromethyl)sulfonyl]amino}benzoate

Description:

Methyl 5-chloro-2-{[(trifluoromethyl)sulfonyl]amino}benzoate, with CAS number 84466-05-7, is a chemical compound characterized by its complex structure, which includes a benzoate moiety substituted with a chlorine atom and a sulfonamide group featuring a trifluoromethyl group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and agrochemicals due to its bioactive properties. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, making it an attractive candidate for drug development. Additionally, the sulfonamide functional group can impart unique reactivity and interaction capabilities, influencing its behavior in biological systems. Methyl 5-chloro-2-{[(trifluoromethyl)sulfonyl]amino}benzoate is likely to exhibit moderate to high stability under standard conditions, but specific handling and storage guidelines should be followed to ensure safety and integrity. As with many synthetic compounds, it is essential to consider its environmental impact and regulatory status when utilized in research or industrial applications.

Formula: C₉H₇ClF₃NO₄S

InChI: InChI=1/C9H7ClF3NO4S/c1-18-8(15)6-4-5(10)2-3-7(6)14-19(16,17)9(11,12)13/h2-4,14H,1H3

InChI key: KBHDSWIXRODKSZ-UHFFFAOYSA-N

SMILES: COC(=O)c1cc(ccc1NS(=O)(=O)C(F)(F)F)Cl

Synonyms:

• 84466-05-7
• Benzoic Acid, 5-Chloro-2-[[(Trifluoromethyl)Sulfonyl]Amino]-, Methyl Ester
• Methyl-5-chlor-2-{[(trifluormethyl)sulfonyl]amino}benzoat

Amidoflumet

CAS: 84466-05-7

Ref: 7W-GW3472