CymitQuimica logo

CAS 844679-02-3

:

9-[1,1'-Biphenyl]-3-yl-10-bromo-anthracene

Description:
9-[1,1'-Biphenyl]-3-yl-10-bromo-anthracene, with the CAS number 844679-02-3, is an organic compound characterized by its polycyclic aromatic structure, which includes an anthracene core substituted with a biphenyl group and a bromine atom. This compound typically exhibits properties associated with aromatic compounds, such as high stability and a tendency to participate in π-π stacking interactions. The presence of the bromine atom introduces halogenation, which can influence its reactivity and solubility in various solvents. The biphenyl substituent can enhance the compound's electronic properties, making it of interest in organic electronics and photonic applications. Additionally, due to its structural features, it may exhibit fluorescence, making it useful in optoelectronic devices. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its behavior in different chemical environments can be studied through various analytical methods, including spectroscopy and chromatography. Overall, this compound represents a fascinating intersection of organic chemistry and materials science.
Formula:C26H17Br
InChI:InChI=1S/C26H17Br/c27-26-23-15-6-4-13-21(23)25(22-14-5-7-16-24(22)26)20-12-8-11-19(17-20)18-9-2-1-3-10-18/h1-17H
InChI key:WCMCZLIOCXISPX-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=CC=C2)C3=C4C=CC=CC4=C(C5=CC=CC=C53)Br
Found 4 products.