CymitQuimica logo

CAS 84478-87-5

:

2-Bromo-4-fluoro-5-nitrophenol

Description:
2-Bromo-4-fluoro-5-nitrophenol is an organic compound characterized by its aromatic structure, which includes a phenolic hydroxyl group and multiple halogen and nitro substituents. The presence of a bromine atom at the second position, a fluorine atom at the fourth position, and a nitro group at the fifth position of the phenol ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a yellowish color. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in electrophilic substitution reactions. The nitro group enhances its electrophilic character, while the halogen substituents can influence its solubility and reactivity. Safety considerations are important when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken. Overall, 2-Bromo-4-fluoro-5-nitrophenol is a significant compound in synthetic organic chemistry.
Formula:C6H3BrFNO3
InChI:InChI=1/C6H3BrFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H
InChI key:NVNFKCCUJKPLLT-UHFFFAOYSA-N
SMILES:c1c(c(cc(c1F)N(=O)=O)O)Br
Synonyms:
  • Phenol, 2-bromo-4-fluoro-5-nitro-
Found 4 products.