CymitQuimica logo

CAS 844856-54-8

:

3-Bromo-3′-methyl-1,1′-biphenyl

Description:
3-Bromo-3′-methyl-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 3-position of one phenyl ring and a methyl group at the 3′-position of the other ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of liquid crystals or as intermediates in pharmaceuticals. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile building block in organic chemistry. Additionally, the compound's physical and chemical properties, such as melting point, boiling point, and reactivity, can be influenced by the steric and electronic effects of the substituents on the biphenyl framework. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C13H11Br
InChI:InChI=1S/C13H11Br/c1-10-4-2-5-11(8-10)12-6-3-7-13(14)9-12/h2-9H,1H3
InChI key:InChIKey=VIXCLEUVOBRQQI-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1)C2=CC(C)=CC=C2
Synonyms:
  • 1-Bromo-3-(3-methylphenyl)benzene
  • 3-Bromo-3′-methylbiphenyl
  • 3-Bromo-3′-methyl-1,1′-biphenyl
  • 1,1′-Biphenyl, 3-bromo-3′-methyl-
Found 2 products.