CAS 845267-78-9

tert-butyl 2,4-dioxopiperidine-1-carboxylate

Description:

Tert-butyl 2,4-dioxopiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features two carbonyl groups (dioxo) at the 2 and 4 positions of the piperidine ring, contributing to its reactivity and potential applications in organic synthesis. The tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents, and can influence its biological activity. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. This compound is often used in medicinal chemistry and drug development due to its structural features that may interact with biological targets. Its CAS number, 845267-78-9, allows for precise identification in chemical databases and literature. Overall, tert-butyl 2,4-dioxopiperidine-1-carboxylate is a versatile compound with significant implications in synthetic organic chemistry and pharmacology.

Formula: C₁₀H₁₅NO₄

InChI: InChI=1/C10H15NO4/c1-10(2,3)15-9(14)11-5-4-7(12)6-8(11)13/h4-6H2,1-3H3

InChI key: SLCAHLSQXDNQSF-UHFFFAOYSA-N

SMILES: CC(C)(C)OC(=O)N1CCC(=O)CC1=O

Synonyms:

• 1,1-Dimethylethyl 2,4-dioxo-1-piperidinecarboxylate
• 1-Boc-Piperidine-2,4-dione
• N-Boc-2,4-piperidinedione

TERT-BUTYL 2,4-DIOXOPIPERIDINE-1-CARBOXYLATE

CAS: 845267-78-9

Formula: C₁₀H₁₅NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.2304

Ref: IN-DA004VJ6

tert-Butyl 2,4-dioxopiperidine-1-carboxylate

CAS: 845267-78-9

tert-Butyl 2,4-dioxopiperidine-1-carboxylate

Formula: C₁₀H₁₅NO₄

Purity: 97%

Molecular weight: 213.23

Ref: IN-DG158304

Piperidine-2,4-dione, N-BOC protected

CAS: 845267-78-9

Piperidine-2,4-dione, N-BOC protected

Formula: C₁₀H₁₅NO₄

Purity: >98%

Color and Shape: Solid-Powder

Molecular weight: 213.23039

Ref: 54-OR52261

1-Boc-Piperidine-2,4-dione

CAS: 845267-78-9

Formula: C₁₀H₁₅NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.233

Ref: 10-F046341