CymitQuimica logo

CAS 845305-83-1

:

1-Piperidinecarboxylicacid, 4-(4-piperidinyloxy)-, 1,1-dimethylethyl ester

Description:
1-Piperidinecarboxylic acid, 4-(4-piperidinyloxy)-, 1,1-dimethylethyl ester, identified by CAS number 845305-83-1, is a chemical compound characterized by its piperidine and carboxylic acid functional groups. This compound features a piperidine ring, which is a six-membered ring containing one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The presence of the carboxylic acid moiety indicates that it can participate in acid-base reactions and may exhibit properties typical of carboxylic acids, such as solubility in polar solvents. The ester functionality suggests that it can undergo hydrolysis under certain conditions, releasing the corresponding alcohol and acid. Additionally, the presence of the 1,1-dimethylethyl group (tert-butyl) enhances the steric bulk around the ester, potentially influencing its reactivity and interactions with biological systems. Overall, this compound may have applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities or uses would require further investigation.
Formula:C15H28N2O3
InChI:InChI=1S/C15H28N2O3/c1-15(2,3)20-14(18)17-10-6-13(7-11-17)19-12-4-8-16-9-5-12/h12-13,16H,4-11H2,1-3H3
InChI key:UTDIXFSPTJESFX-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)OC2CCNCC2
Synonyms:
  • 4-[(Piperidin-4-yl)oxy]piperidine-1-carboxylicacid tert-butyl ester
Found 6 products.