CAS 845306-08-3
:tert-butyl 5-bromopyridine-2-carboxylate
Description:
Tert-butyl 5-bromopyridine-2-carboxylate is an organic compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 2-position with a carboxylate group. The tert-butyl group enhances its lipophilicity and steric hindrance, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong acids or bases, which can lead to hydrolysis of the ester functional group. Its solubility is generally higher in organic solvents compared to water, reflecting its hydrophobic nature. The presence of the bromine atom can also facilitate various reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile building block in synthetic chemistry. Additionally, the compound's structure allows for potential applications in medicinal chemistry, where modifications can lead to biologically active derivatives.
Formula:C10H12BrNO2
InChI:InChI=1/C10H12BrNO2/c1-10(2,3)14-9(13)8-5-4-7(11)6-12-8/h4-6H,1-3H3
SMILES:CC(C)(C)OC(=O)c1ccc(cn1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl 5-bromopicolinate
CAS:Formula:C10H12BrNO2Purity:97%Color and Shape:SolidMolecular weight:258.1118tert-Butyl 5-bromopyridine-2-carboxylate
CAS:tert-Butyl 5-bromopyridine-2-carboxylatePurity:97%Color and Shape:SolidMolecular weight:258.11g/moltert-Butyl 5-bromopicolinate
CAS:Formula:C10H12BrNO2Purity:95%Color and Shape:SolidMolecular weight:258.115tert-Butyl 5-bromopyridine-2-carboxylate
CAS:tert-Butyl 5-bromopyridine-2-carboxylate is an arylation agent that is used to synthesize a number of different compounds. It is the most potent arylating agent known, with high yields and low toxicity. The benzyl group provides protection against hydrogen chloride and can be removed by hydrolysis. This agent reacts with a variety of aromatic halides in the presence of copper salts to produce a variety of products. Tert-Butyl 5-bromopyridine-2-carboxylate has been shown to have good pharmacokinetic properties, but it's use as an antibiotic has not been studied.Formula:C10H12BrNO2Purity:Min. 95%Molecular weight:258.11 g/mol



