CAS 84543-36-2

2-chloroethyl-beta-D-fructopyranoside

Description:

2-Chloroethyl-beta-D-fructopyranoside is a chemical compound characterized by its structure, which includes a fructopyranose moiety and a chloroethyl group. This compound is typically classified as a glycoside, where the sugar component is beta-D-fructopyranose, a six-membered ring form of fructose. The presence of the chloroethyl group introduces reactivity, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. The compound is often studied for its biological activity, particularly in relation to its potential effects on glycosylation processes and interactions with biological macromolecules. In terms of physical properties, it may exhibit solubility in polar solvents due to the hydroxyl groups present in the sugar moiety. Safety data should be consulted for handling, as the chloroethyl group can impart toxicity. Overall, 2-chloroethyl-beta-D-fructopyranoside serves as an interesting subject in both synthetic chemistry and biochemistry due to its structural features and potential applications.

Formula: C₈H₁₄ClO₆

InChI: InChI=1/C8H14ClO6/c9-1-2-14-4-8(13)7(12)6(11)5(10)3-15-8/h5-7,10-12H,1-4H2/q-1/t5-,6-,7+,8-/m1/s1

2-(2-chloroethoxy)-2-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol

CAS: 84543-36-2

2-(2-chloroethoxy)-2-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol

Purity: ≥95%

Ref: 54-OR24543

2-Chloroethyl-b-D-fructopyranoside

CAS: 84543-36-2

Ref: 7W-GC2804

2-Chloroethyl-b-D-fructopyranoside

CAS: 84543-36-2

2-Chloroethyl-b-D-fructopyranoside is a stable reagent that is used to prepare 2,4-dichloroacetophenone (2,4-DAAP), which can be used as a crosslinking agent. This reagent is reactive and should be handled with care. It forms a hemoglobin adduct by reacting with the amino groups of hemoglobin. The reaction can be catalyzed by dialdehydes. Affinities for tissue proteins are created through stepwise reactions involving ring-opening reactions or methemoglobin formation. 2-Chloroethyl-b-D-fructopyranoside can be used to synthesize a polymerized affinity column by using the ring opening reaction in an affinity chromatography process.

Formula: C₈H₁₅ClO₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 242.65 g/mol

Ref: 3D-MC00695