CymitQuimica logo

CAS 84543-36-2

:

2-chloroethyl-beta-D-fructopyranoside

Description:
2-Chloroethyl-beta-D-fructopyranoside is a chemical compound characterized by its structure, which includes a fructopyranose moiety and a chloroethyl group. This compound is typically classified as a glycoside, where the sugar component is beta-D-fructopyranose, a six-membered ring form of fructose. The presence of the chloroethyl group introduces reactivity, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. The compound is often studied for its biological activity, particularly in relation to its potential effects on glycosylation processes and interactions with biological macromolecules. In terms of physical properties, it may exhibit solubility in polar solvents due to the hydroxyl groups present in the sugar moiety. Safety data should be consulted for handling, as the chloroethyl group can impart toxicity. Overall, 2-chloroethyl-beta-D-fructopyranoside serves as an interesting subject in both synthetic chemistry and biochemistry due to its structural features and potential applications.
Formula:C8H14ClO6
InChI:InChI=1/C8H14ClO6/c9-1-2-14-4-8(13)7(12)6(11)5(10)3-15-8/h5-7,10-12H,1-4H2/q-1/t5-,6-,7+,8-/m1/s1
InChI key:UNKSWTOXDXZLNE-OOJXKGFFSA-N
SMILES:C1[C@H]([C@H]([C@@H]([C@](O1)(CO)OCCCl)O)O)O
Found 2 products.