CAS 84545-30-2

5-{3-[N''-(2,2,2-trifluoroethyl)carbamimidamido]-1H-pyrazol-1-yl}pentanamide

Description:

5-{3-[N''-(2,2,2-trifluoroethyl)carbamimidamido]-1H-pyrazol-1-yl}pentanamide, identified by its CAS number 84545-30-2, is a chemical compound that features a complex structure incorporating a pyrazole ring and a pentanamide chain. This substance is characterized by the presence of a trifluoroethyl group, which contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carbamimidamido functional group suggests that it may exhibit properties typical of guanidine derivatives, potentially influencing its reactivity and interactions with biological targets. The compound's structure indicates it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential for modulating biological pathways. Additionally, the presence of fluorine atoms often enhances metabolic stability and bioavailability. Overall, this compound's intricate design and functional groups suggest it could play a role in various chemical and biological applications, warranting further investigation into its properties and potential uses.

Formula: C₁₁H₁₇F₃N₆O

InChI: InChI=1/C11H17F3N6O/c12-11(13,14)7-17-10(16)18-9-4-6-20(19-9)5-2-1-3-8(15)21/h4,6H,1-3,5,7H2,(H2,15,21)(H3,16,17,18,19)

InChI key: ALCSGJCIESECFD-UHFFFAOYSA-N

SMILES: C(CCn1ccc(=NC(=N)NCC(F)(F)F)[nH]1)CC(=N)O

Synonyms:

• 1H-Pyrazole-1-pentanamide, 3-[[(1E)-amino[(2,2,2-trifluoroethyl)amino]methylene]amino]-
• 5-{3-[(E)-{Amino[(2,2,2-trifluoroethyl)amino]methylene}amino]-1H-pyrazol-1-yl}pentanamide

ICI 162,846

CAS: 84545-30-2

ICI 162,846

Formula: C₁₁H₁₇F₃N₆O

Purity: 99.5%

Molecular weight: 306.29

Ref: 54-BUP08408

ICI 162846

CAS: 84545-30-2

Formula: C₁₁H₁₇F₃N₆O

Molecular weight: 306.2875

Ref: IN-DA00G62E

ICI 162846

CAS: 84545-30-2

Formula: C₁₁H₁₇F₃N₆O

Color and Shape: Neat

Ref: TR-I163873

ICI 162,846

CAS: 84545-30-2

ICI 162,846 is an orally active and potent H2 receptor antagonist that inhibits gastric secretion and may be used in the study of duodenal ulcers.

Formula: C₁₁H₁₇F₃N₆O

Purity: 99.76%

Color and Shape: Solid

Molecular weight: 306.29

Ref: TM-T22848