CymitQuimica logo

CAS 845617-99-4

:

3-Chloro-5-(trifluoromethyl)pyridazine

Description:
3-Chloro-5-(trifluoromethyl)pyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic and steric properties. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it an attractive moiety in drug design. Additionally, the chlorine substituent can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's stability and reactivity can be influenced by the presence of these substituents, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C5H2ClF3N2
InChI:InChI=1S/C5H2ClF3N2/c6-4-1-3(2-10-11-4)5(7,8)9/h1-2H
InChI key:InChIKey=GEFXHRCGAYIERB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(Cl)N=NC1
Synonyms:
  • 3-Chloro-5-trifluoromethylpyridazine
  • Pyridazine, 3-chloro-5-(trifluoromethyl)-
  • 3-Chloro-5-(trifluoromethyl)pyridazine
Found 5 products.