CymitQuimica logo

CAS 84562-48-1

:

4-Dimethylamino-2-methoxybenzaldehyde

Description:
4-Dimethylamino-2-methoxybenzaldehyde, with the CAS number 84562-48-1, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a dimethylamino group and a methoxy group, contributing to its unique chemical properties. It typically appears as a yellow to orange crystalline solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic nature. The presence of the dimethylamino group imparts basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, this compound is often utilized in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Its reactivity and functional groups make it a valuable compound in research and industrial applications, particularly in the development of fluorescent materials and as a building block in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3
InChI key:HGDRXADJVGVGBC-UHFFFAOYSA-N
SMILES:CN(C)c1ccc(C=O)c(c1)OC
Found 7 products.