CymitQuimica logo

CAS 845658-68-6

:

N-[(5-Bromo-2-furyl)methyl]-2-(methylsulfonyl)ethanamine

Description:
N-[(5-Bromo-2-furyl)methyl]-2-(methylsulfonyl)ethanamine is a chemical compound characterized by its unique structural features, which include a brominated furyl group and a methylsulfonyl moiety. The presence of the bromine atom enhances its reactivity and potential biological activity, while the furyl ring contributes to its aromatic properties. The methylsulfonyl group is known for its ability to enhance solubility and stability in various solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitutions and functional group transformations. As with many compounds containing heterocycles and functional groups, careful consideration of its stability, reactivity, and potential toxicity is essential for any practical applications. Overall, N-[(5-Bromo-2-furyl)methyl]-2-(methylsulfonyl)ethanamine represents a complex molecule with potential utility in various chemical and biological contexts.
Formula:C8H12BrNO3S
InChI:InChI=1S/C8H12BrNO3S/c1-14(11,12)5-4-10-6-7-2-3-8(9)13-7/h2-3,10H,4-6H2,1H3
InChI key:MSUXPEPRUITWOI-UHFFFAOYSA-N
SMILES:CS(=O)(=O)CCNCC1=CC=C(O1)Br
Synonyms:
  • N-((5-bromofuran-2-yl)methyl)-2-(methylsulfonyl)ethan-1-amine
  • 2-Furanmethanamine, 5-bromo-N-[2-(methylsulfonyl)ethyl]-
  • N-[(5-Bromo-2-furyl)methyl]-2-(methylsulfonyl)ethanamine
Found 2 products.