CAS 845673-74-7

Formula: C22H30O3

InChI: InChI=1S/C22H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)19-20-22(24)25/h3-4,6-7,9-10,12-13,15-18H,2,5,8,11,14,19-20H2,1H3,(H,24,25)/b4-3-,7-6-,10-9-,13-12-,16-15-,18-17+

InChI key: UHNUULCIKILOHW-PQVBWYSWSA-N

SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C=C\C(=O)CCC(=O)O

4-oxo Docosahexaenoic Acid

CAS: 845673-74-7

4-oxo DHA, potential DHA metabolite, has anti-cancer properties and activates PPARγ with EC50 of 8-16 μM.

Formula: C₂₂H₃₀O₃

Color and Shape: Solid

Molecular weight: 342.479

Ref: TM-T36868

4-oxo-5(E),7(Z),10(Z),13(Z),16(Z),19(Z)-docosahexaenoic acid

CAS: 845673-74-7

Formula: C22H30O3

Purity: >90%

Color and Shape: In solution, Ethanol

Molecular weight: 342.47

Ref: 48-13-2205

4-Oxo-5(E),7(Z),10(Z),13(Z),16(Z),19(Z)-docosahexaenoic acid

CAS: 845673-74-7

4-Oxo-5(E),7(Z),10(Z),13(Z),16(Z),19(Z)-docosahexaenoic acid is a specialized type of docosanoid, which is an oxidized form of docosahexaenoic acid (DHA). This compound is sourced primarily from marine organisms where DHA is abundant, such as algae and fish oils. The mode of action for 4-oxo-DHA involves its potential role as a signaling lipid, which may participate in cellular processes such as inflammation, apoptosis, and cell membrane dynamics.

Formula: C₂₂H₃₀O₃

Purity: Min. 95%

Molecular weight: 342.5 g/mol

Ref: 3D-VIB67374