CymitQuimica logo

CAS 845729-41-1

:

3-Morpholinone, 4-(2-nitrophenyl)-

Description:
3-Morpholinone, 4-(2-nitrophenyl)-, with the CAS number 845729-41-1, is an organic compound characterized by its morpholinone structure, which includes a morpholine ring and a nitrophenyl substituent. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of the nitro group (-NO2) on the phenyl ring contributes to its potential reactivity and polarity, influencing its chemical behavior and interactions. Morpholinones are often studied for their biological activity, including potential pharmaceutical applications, due to their ability to interact with various biological targets. The compound may also exhibit properties such as moderate stability under standard conditions, but it is essential to handle it with care due to the presence of the nitro group, which can be sensitive to reduction reactions. Overall, 3-Morpholinone, 4-(2-nitrophenyl)- is of interest in both synthetic organic chemistry and medicinal chemistry for its structural features and potential applications.
Formula:C10H10N2O4
InChI:InChI=1S/C10H10N2O4/c13-10-7-16-6-5-11(10)8-3-1-2-4-9(8)12(14)15/h1-4H,5-7H2
InChI key:OXVFGUUCIPAZSM-UHFFFAOYSA-N
SMILES:C1COCC(=O)N1C2=CC=CC=C2[N+](=O)[O-]
Found 8 products.