CymitQuimica logo

CAS 845790-44-5

:

5-(4-chloro-3-fluorophenyl)-5-oxopentanoic acid

Description:
5-(4-Chloro-3-fluorophenyl)-5-oxopentanoic acid, identified by its CAS number 845790-44-5, is an organic compound characterized by its unique molecular structure, which includes a pentanoic acid backbone with a ketone functional group and a substituted aromatic ring. The presence of a 4-chloro and 3-fluoro substituent on the phenyl group contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid functional group, while the aromatic ring may enhance lipophilicity. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substituents can influence biological interactions. Additionally, the compound's reactivity may be influenced by the electron-withdrawing effects of the halogen substituents, which can affect its acidity and overall stability. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of halogens, which can pose environmental and health risks.
Formula:C11H10ClFO3
InChI:InChI=1/C11H10ClFO3/c12-8-5-4-7(6-9(8)13)10(14)2-1-3-11(15)16/h4-6H,1-3H2,(H,15,16)
InChI key:GWPVAONYRKBXDR-UHFFFAOYSA-N
SMILES:C(CC(=O)c1ccc(c(c1)F)Cl)CC(=O)O
Synonyms:
  • Benzenepentanoic acid, 4-chloro-3-fluoro-delta-oxo-
Found 2 products.