CymitQuimica logo

CAS 845826-99-5

:

5-(4-Fluorophenyl)pyridine-2-carboxylic acid

Description:
5-(4-Fluorophenyl)pyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 5-position with a 4-fluorophenyl group. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of both the aromatic fluorophenyl group and the carboxylic acid functionality, which can participate in various chemical reactions and interactions. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity. Additionally, the presence of the carboxylic acid group allows for potential hydrogen bonding, which can be crucial for binding interactions in biological systems. Overall, this compound's unique structural features make it of interest for further research in drug development and other chemical applications.
Formula:C12H8FNO2
InChI:InChI=1/C12H8FNO2/c13-10-4-1-8(2-5-10)9-3-6-11(12(15)16)14-7-9/h1-7H,(H,15,16)
InChI key:BVDMIKPXCXAARR-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1ccc(C(=O)O)nc1)F
Synonyms:
  • 2-Pyridinecarboxylic acid, 5-(4-fluorophenyl)-
  • 5-(4-Fluorophenyl)-2-pyridinecarboxylic acid
  • 5-(4-Fluorophenyl)picolinic acid
  • T6Nj Bvq Er Df
  • 5-(4-Fluorophenyl)pyridine-2-carboxylic acid
Found 5 products.