CymitQuimica logo

CAS 845827-13-6

:

Pyridine,5-bromo-2-(difluoromethyl)-

Description:
Pyridine, 5-bromo-2-(difluoromethyl)-, is a heterocyclic organic compound characterized by a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a difluoromethyl group at the 2-position introduces significant reactivity and polarity to the molecule. This compound typically exhibits properties associated with both aromatic compounds and halogenated derivatives, such as increased lipophilicity and potential for electrophilic substitution reactions. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic reactions due to their ability to participate in nucleophilic and electrophilic reactions. The difluoromethyl group can enhance the compound's biological activity and influence its interaction with biological targets. Additionally, the presence of the bromine atom can facilitate further functionalization, making it a valuable building block in synthetic chemistry. Overall, this compound's unique structure and substituents contribute to its potential applications in various chemical and pharmaceutical contexts.
Formula:C6H4BrF2N
InChI:InChI=1S/C6H4BrF2N/c7-4-1-2-5(6(8)9)10-3-4/h1-3,6H
InChI key:QXLZRIGSWWQOLG-UHFFFAOYSA-N
SMILES:C1=CC(=NC=C1Br)C(F)F
Synonyms:
  • 5-Bromo-2-(difluoromethyl)pyridine
Found 5 products.