CymitQuimica logo

CAS 845866-78-6

:

1-Bromo-2-iodo-5-(trifluoromethoxy)benzene

Description:
1-Bromo-2-iodo-5-(trifluoromethoxy)benzene is an aromatic halogenated compound characterized by the presence of both bromine and iodine substituents on the benzene ring, along with a trifluoromethoxy group. This compound features a benzene core, which is a stable and planar structure, allowing for significant delocalization of electrons. The bromine and iodine atoms introduce notable reactivity due to their electronegative nature, making the compound useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its biological activity, making it a candidate for pharmaceutical development. Additionally, the presence of multiple halogens can affect the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. Overall, 1-Bromo-2-iodo-5-(trifluoromethoxy)benzene is a versatile compound with potential applications in research and industry, particularly in the development of new materials and drugs.
Formula:C7H3BrF3IO
InChI:InChI=1S/C7H3BrF3IO/c8-4-1-5(12)3-6(2-4)13-7(9,10)11/h1-3H
InChI key:SJEYHNDEVIRTLB-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1Br)I)OC(F)(F)F
Found 4 products.