CymitQuimica logo

CAS 84594-95-6

:

4-methoxy-2-nitro-1-phenoxy-benzene

Description:
4-Methoxy-2-nitro-1-phenoxy-benzene, identified by its CAS number 84594-95-6, is an organic compound characterized by the presence of a methoxy group, a nitro group, and a phenoxy group attached to a benzene ring. This compound typically exhibits a yellow to orange color and is likely to be a solid at room temperature. Its molecular structure suggests it may possess moderate polarity due to the presence of the nitro and methoxy substituents, which can influence its solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can affect the reactivity of the compound in electrophilic aromatic substitution reactions. Additionally, the methoxy group can provide some electron-donating characteristics, potentially stabilizing the aromatic system. 4-Methoxy-2-nitro-1-phenoxy-benzene may have applications in organic synthesis, materials science, or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and may pose health risks.
Formula:C13H11NO4
InChI:InChI=1S/C13H11NO4/c1-17-11-7-8-13(12(9-11)14(15)16)18-10-5-3-2-4-6-10/h2-9H,1H3
InChI key:QVCYQPIZAWIRIP-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)OC2=CC=CC=C2)[N+](=O)[O-]
Found 6 products.