CymitQuimica logo

CAS 846023-58-3

:

2-Formylfuran-4-boronic acid pinacol ester

Description:
2-Formylfuran-4-boronic acid pinacol ester is an organoboron compound characterized by the presence of a furan ring, a formyl group, and a boronic acid moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and ethanol. The boronic acid functionality allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The pinacol ester group enhances the stability of the boronic acid, facilitating its handling and storage. Additionally, the presence of the formyl group contributes to its reactivity, allowing for further functionalization. The compound is often used in the development of pharmaceuticals and agrochemicals due to its ability to form covalent bonds with various nucleophiles. Overall, 2-Formylfuran-4-boronic acid pinacol ester is a versatile intermediate in synthetic organic chemistry, with applications in the construction of complex molecular architectures.
Formula:C11H15BO4
InChI:InChI=1S/C11H15BO4/c1-10(2)11(3,4)16-12(15-10)8-5-9(6-13)14-7-8/h5-7H,1-4H3
InChI key:YHEMDDZDHYKQGZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=COC(=C2)C=O
Synonyms:
  • 5-Formylfuran-3-boronic acid pinacol ester
  • 2-Furancarboxaldehyde,4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carbaldehyde
Found 6 products.