CAS 84635-54-1
:[(2S,3R,4R,5S,6R)-4,5-diacetoxy-2-methyl-6-methylsulfanyl-tetrahydropyran-3-yl] acetate
Description:
The chemical substance with the name "[(2S,3R,4R,5S,6R)-4,5-diacetoxy-2-methyl-6-methylsulfanyl-tetrahydropyran-3-yl] acetate" and CAS number 84635-54-1 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of a methylsulfanyl group indicates that it may exhibit unique properties related to sulfur chemistry, such as increased nucleophilicity. The stereochemistry of the molecule, denoted by its specific configuration at various chiral centers, suggests that it may have distinct biological activities or interactions, making it of interest in medicinal chemistry. Additionally, the diacetoxy substitution can enhance solubility and stability, influencing its behavior in various chemical environments. Overall, this compound's structural complexity and functional diversity make it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C13H20O7S
InChI:InChI=1/C13H20O7S/c1-6-10(18-7(2)14)11(19-8(3)15)12(20-9(4)16)13(17-6)21-5/h6,10-13H,1-5H3/t6-,10+,11+,12-,13+/m0/s1
Synonyms:- β-L-galactopyranoside, methyl 6-deoxy-1-thio-, triacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3,4-Tri-O-acetyl-1-thio-β-L-fucopyranoside
CAS:Methyl 2,3,4-Tri-O-acetyl-1-thio-β-L-fucopyranosideFormula:C13H20O7SPurity:>98.0%Molecular weight:320.36Methyl2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside
CAS:Formula:C13H20O7SPurity:98.0%Color and Shape:SolidMolecular weight:320.3587Methyl 2,3,4-Tri-O-acetyl-1-thio-β-L-fucopyranoside
CAS:Formula:C13H20O7SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:320.36Methyl 2,3,4-tri-O-acetyl-β-L-thiofucopyranoside
CAS:Methyl 2,3,4-tri-O-acetyl-b-L-thiofucopyranoside is a ferrite that is important for the growth of cells. It can be used as a growth factor to promote the growth of cells. Covid®-19 pandemic A/Aureus strain is resistant to this drug and it has been shown to inhibit cellular transformation in human epidermal cells. The drug also reduces the size and number of cancerous lesions in mice by inhibiting tumor angiogenesis. Methyl 2,3,4-tri-O-acetyl-b-L-thiofucopyranoside can cause an overload of Ca2+ ions in the cell, which may lead to apoptosis or necrosis.
Formula:C13H20O7SPurity:Min. 95%Molecular weight:320.36 g/mol





