CAS 84680-54-6

N-[(1S)-1-Carboxy-3-phenylpropyl]-L-alanyl-L-proline hydrate (1:2)

Description:

N-[(1S)-1-Carboxy-3-phenylpropyl]-L-alanyl-L-proline hydrate (1:2), with the CAS number 84680-54-6, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure comprising two amino acids, L-alanine and L-proline, along with a phenylpropyl side chain. The presence of the carboxylic acid functional group contributes to its acidic properties, while the proline and alanine residues provide it with unique steric and electronic characteristics. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its solubility and stability. This compound may exhibit biological activity, potentially serving as a peptide or a building block in peptide synthesis. Its specific interactions and applications would depend on its conformation and the presence of functional groups, making it of interest in pharmaceutical and biochemical research. As with many amino acid derivatives, it may also play a role in various metabolic pathways or serve as a model for studying protein interactions.

Formula:C₁₈H₂₄N₂O₅·2H₂O

InChI:InChI=1S/C18H24N2O5.2H2O/c1-12(16(21)20-11-5-8-15(20)18(24)25)19-14(17(22)23)10-9-13-6-3-2-4-7-13;;/h2-4,6-7,12,14-15,19H,5,8-11H2,1H3,(H,22,23)(H,24,25);2*1H2/t12-,14-,15-;;/m0../s1

InChI key:InChIKey=MZYVOFLIPYDBGD-MLZQUWKJSA-N

SMILES:C([C@@H](N[C@@H](CCC1=CC=CC=C1)C(O)=O)C)(=O)N2[C@H](C(O)=O)CCC2.O

Synonyms:

1-(N-((S)-1-Carboxy-3-phenylpropyl)-L-alanyl)-L-proline dihydrate
2-[N-(1-carboxy-3-phenylpropyl)alanyl]pyrrolidine-1-carboxylic acid dihydrate
L</smallcap>-Proline, 1-[N-(1-carboxy-3-phenylpropyl)-<smallcap>L-alanyl]-, dihydrate, (S)-
L</smallcap>-Proline, N-[(1S)-1-carboxy-3-phenylpropyl]-<smallcap>L-alanyl-, dihydrate
L</smallcap>-Proline, N-[(1S)-1-carboxy-3-phenylpropyl]-<smallcap>L-alanyl-, hydrate (1:2)
L-Proline, 1-(N-(1-carboxy-3-phenylpropyl)-L-alanyl)-, dihydrate, (S)-
N-[(1R)-1-carboxy-3-phenylpropyl]-L-alanyl-D-proline
N-[(1S)-1-Carboxy-3-phenylpropyl]-L</smallcap>-alanyl-<smallcap>L-proline hydrate (1:2)
Unii-Gv0O7Es0R3
L-Proline, N-[(1S)-1-carboxy-3-phenylpropyl]-L-alanyl-, dihydrate
N-[(1S)-1-Carboxy-3-phenylpropyl]-L-alanyl-L-proline hydrate (1:2)
See more synonyms