CymitQuimica logo

CAS 847170-51-8

:

Quinoline, 1-[(4-chloro-3-nitrophenyl)sulfonyl]-1,2,3,4-tetrahydro-

Description:
Quinoline, 1-[(4-chloro-3-nitrophenyl)sulfonyl]-1,2,3,4-tetrahydro- is a chemical compound characterized by its complex structure, which includes a quinoline core fused with a tetrahydro group and a sulfonyl moiety attached to a chloronitrophenyl group. This compound typically exhibits properties associated with both quinoline derivatives and sulfonamides, including potential biological activity. The presence of the chloro and nitro substituents on the phenyl ring can influence its reactivity and solubility, making it of interest in medicinal chemistry and material science. Quinoline derivatives are often studied for their pharmacological properties, including antimicrobial and antitumor activities. The sulfonyl group can enhance the compound's ability to interact with biological targets, potentially leading to the development of new therapeutic agents. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C15H13ClN2O4S
InChI:InChI=1S/C15H13ClN2O4S/c16-13-8-7-12(10-15(13)18(19)20)23(21,22)17-9-3-5-11-4-1-2-6-14(11)17/h1-2,4,6-8,10H,3,5,9H2
InChI key:LEQSFEFOQFAWKA-UHFFFAOYSA-N
SMILES:C1CC2=CC=CC=C2N(C1)S(=O)(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-]
Found 4 products.