CymitQuimica logo

CAS 847416-99-3

:

tert-Butyl (3-oxocyclopentyl)carbamate

Description:
Tert-Butyl (3-oxocyclopentyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and influencing its reactivity and solubility. The presence of the 3-oxocyclopentyl moiety indicates a cyclopentane ring with a ketone functional group, contributing to its unique chemical properties. Typically, compounds like this exhibit moderate polarity due to the combination of hydrophobic tert-butyl and polar carbamate functionalities. They may participate in various chemical reactions, including nucleophilic substitutions and hydrolysis, depending on the conditions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in drug design, where modifications to the carbamate group can enhance biological activity or selectivity. Overall, tert-Butyl (3-oxocyclopentyl)carbamate is a versatile compound with interesting chemical behavior and potential utility in synthetic organic chemistry.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h7H,4-6H2,1-3H3,(H,11,13)
InChI key:CLOXAWYNXXEWBT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CCC(=O)C1
Synonyms:
  • tert-butyl N-(3-oxocyclopentyl)carbamate
Found 5 products.