CymitQuimica logo

CAS 84743-29-3

:

cis-10-pentadecenoic acid

Description:
Cis-10-pentadecenoic acid, with the CAS number 84743-29-3, is a long-chain unsaturated fatty acid characterized by the presence of a cis double bond located at the 10th carbon from the carboxylic acid end of the molecule. This fatty acid typically features a 15-carbon backbone, making it a medium to long-chain fatty acid. The cis configuration of the double bond influences its physical properties, such as lowering the melting point compared to its trans isomer, resulting in a more fluid structure at room temperature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Cis-10-pentadecenoic acid is of interest in various fields, including biochemistry and nutrition, as it may play a role in cellular processes and has potential applications in the development of functional foods and nutraceuticals. Additionally, its structural characteristics make it a subject of study in the synthesis of bioactive compounds and in the formulation of surfactants and emulsifiers.
Formula:C15H28O2
InChI:InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h5-6H,2-4,7-14H2,1H3,(H,16,17)/b6-5-
InChI key:APXSAEQXOXTDAM-WAYWQWQTSA-N
SMILES:CCCC/C=C\CCCCCCCCC(=O)O
Found 7 products.